C18H21NO8 — CID 70404164
but-2-enedioic acid;(2S,7S)-6-methyl-3,10,13,15-tetraoxa-6-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),12(16),17-triene (PubChem CID 70404164) has the molecular formula C18H21NO8 and a molecular weight of 379.37 g/mol. Its IUPAC name is but-2-enedioic acid;(2S,7S)-6-methyl-3,10,13,15-tetraoxa-6-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),12(16),17-triene.
| Compound Name | but-2-enedioic acid;(2S,7S)-6-methyl-3,10,13,15-tetraoxa-6-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),12(16),17-triene |
|---|---|
| PubChem CID | 70404164 |
| Molecular Formula | C18H21NO8 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | but-2-enedioic acid;(2S,7S)-6-methyl-3,10,13,15-tetraoxa-6-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),12(16),17-triene |
| SMILES | CN1CCO[C@H]2c3ccc4c(c3OCC[C@@H]21)OCO4.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C14H17NO4.C4H4O4/c1-15-5-7-17-12-9-2-3-11-14(19-8-18-11)13(9)16-6-4-10(12)15;5-3(6)1-2-4(7)8/h2-3,10,12H,4-8H2,1H3;1-2H,(H,5,6)(H,7,8)/t10-,12-;/m0./s1 |
| InChIKey | PYJPOHONBAPQKW-JGAZGGJJSA-N |
| XLogP | 1.28 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|