C21H26O4 — CID 70404305
[4-(cyclohexen-1-yl)-1-(4-methoxyphenyl)cyclohex-3-en-1-yl] methyl carbonate (PubChem CID 70404305) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is [4-(cyclohexen-1-yl)-1-(4-methoxyphenyl)cyclohex-3-en-1-yl] methyl carbonate.
| Compound Name | [4-(cyclohexen-1-yl)-1-(4-methoxyphenyl)cyclohex-3-en-1-yl] methyl carbonate |
|---|---|
| PubChem CID | 70404305 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [4-(cyclohexen-1-yl)-1-(4-methoxyphenyl)cyclohex-3-en-1-yl] methyl carbonate |
| SMILES | COC(=O)OC1(c2ccc(OC)cc2)CC=C(C2=CCCCC2)CC1 |
| InChI | InChI=1S/C21H26O4/c1-23-19-10-8-18(9-11-19)21(25-20(22)24-2)14-12-17(13-15-21)16-6-4-3-5-7-16/h6,8-12H,3-5,7,13-15H2,1-2H3 |
| InChIKey | HJEPRODIQHIXQD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |