C12H15N3 — CID 70404309
4a,5,6,7,7a,11a-hexahydropyrazino[1,2-a][1,4]benzodiazepine (PubChem CID 70404309) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 4a,5,6,7,7a,11a-hexahydropyrazino[1,2-a][1,4]benzodiazepine.
| Compound Name | 4a,5,6,7,7a,11a-hexahydropyrazino[1,2-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 70404309 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 4a,5,6,7,7a,11a-hexahydropyrazino[1,2-a][1,4]benzodiazepine |
| SMILES | C1=CC2CNCC3C=NC=CN3C2C=C1 |
| InChI | InChI=1S/C12H15N3/c1-2-4-12-10(3-1)7-14-9-11-8-13-5-6-15(11)12/h1-6,8,10-12,14H,7,9H2 |
| InChIKey | QKWFRGGDHCMRBP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |