About 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine
6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine (PubChem CID 70404778) has the molecular formula C14H15NS
and a molecular weight of 229.35 g/mol. Its IUPAC name is 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine.
Molecular Properties
| Compound Name | 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine |
| PubChem CID | 70404778 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine |
| SMILES | CSc1ccc2c3c(cccc13)CC(N)C2 |
| InChI | InChI=1S/C14H15NS/c1-16-13-6-5-10-8-11(15)7-9-3-2-4-12(13)14(9)10/h2-6,11H,7-8,15H2,1H3 |
| InChIKey | OCIWTKHBXBQEPR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine?
The IUPAC name of 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine (CID 70404778) is 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine.
What is the SMILES notation for 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine?
The canonical SMILES for 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine is CSc1ccc2c3c(cccc13)CC(N)C2.
What is the InChIKey of 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine?
The InChIKey is OCIWTKHBXBQEPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NS/c1-16-13-6-5-10-8-11(15)7-9-3-2-4-12(13)14(9)10/h2-6,11H,7-8,15H2,1H3.
What are the key properties of 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine?
6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine has a molecular weight of 229.35 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfanyl-2,3-dihydro-1H-phenalen-2-amine is sourced from PubChem (CID 70404778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).