C21H27N5O3S — CID 70405131
1-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-2-(5-methyl-1,2,6-thiadiazin-2-yl)ethanol (PubChem CID 70405131) has the molecular formula C21H27N5O3S and a molecular weight of 429.55 g/mol. Its IUPAC name is 1-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-2-(5-methyl-1,2,6-thiadiazin-2-yl)ethanol.
| Compound Name | 1-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-2-(5-methyl-1,2,6-thiadiazin-2-yl)ethanol |
|---|---|
| PubChem CID | 70405131 |
| Molecular Formula | C21H27N5O3S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 1-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-2-(5-methyl-1,2,6-thiadiazin-2-yl)ethanol |
| SMILES | COc1cc2ncnc(N3CCC(C(O)CN4C=CC(C)=NS4)CC3)c2cc1OC |
| InChI | InChI=1S/C21H27N5O3S/c1-14-4-9-26(30-24-14)12-18(27)15-5-7-25(8-6-15)21-16-10-19(28-2)20(29-3)11-17(16)22-13-23-21/h4,9-11,13,15,18,27H,5-8,12H2,1-3H3 |
| InChIKey | DFRXTCTUWJCJAX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|