C14H20N4O — CID 70405157
N,N-diethyl-5-ethylimino-3-phenyl-1,2,4-oxadiazol-4-amine (PubChem CID 70405157) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is N,N-diethyl-5-ethylimino-3-phenyl-1,2,4-oxadiazol-4-amine.
| Compound Name | N,N-diethyl-5-ethylimino-3-phenyl-1,2,4-oxadiazol-4-amine |
|---|---|
| PubChem CID | 70405157 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N,N-diethyl-5-ethylimino-3-phenyl-1,2,4-oxadiazol-4-amine |
| SMILES | CC/N=c1\onc(-c2ccccc2)n1N(CC)CC |
| InChI | InChI=1S/C14H20N4O/c1-4-15-14-18(17(5-2)6-3)13(16-19-14)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3/b15-14- |
| InChIKey | HQNSZBMYELCNTB-PFONDFGASA-N |
| XLogP | 2.04 |
| TPSA | 46.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |