C17H16N4O6 — CID 7040519
4-nitro-N-[(2S)-2-[(4-nitrobenzoyl)amino]propyl]benzamide (PubChem CID 7040519) has the molecular formula C17H16N4O6 and a molecular weight of 372.34 g/mol. Its IUPAC name is 4-nitro-N-[(2S)-2-[(4-nitrobenzoyl)amino]propyl]benzamide.
| Compound Name | 4-nitro-N-[(2S)-2-[(4-nitrobenzoyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 7040519 |
| Molecular Formula | C17H16N4O6 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-nitro-N-[(2S)-2-[(4-nitrobenzoyl)amino]propyl]benzamide |
| SMILES | C[C@@H](CNC(=O)c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16N4O6/c1-11(19-17(23)13-4-8-15(9-5-13)21(26)27)10-18-16(22)12-2-6-14(7-3-12)20(24)25/h2-9,11H,10H2,1H3,(H,18,22)(H,19,23)/t11-/m0/s1 |
| InChIKey | JRINMZUBOOCAEO-NSHDSACASA-N |
| XLogP | 2.05 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|