About N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide
N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 7040530) has the molecular formula C22H16ClN3O
and a molecular weight of 373.84 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide |
| PubChem CID | 7040530 |
| Molecular Formula | C22H16ClN3O |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H16ClN3O/c23-17-11-13-18(14-12-17)24-22(27)20-15-26(19-9-5-2-6-10-19)25-21(20)16-7-3-1-4-8-16/h1-15H,(H,24,27) |
| InChIKey | BURNVDYRJIDPTD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide?
The IUPAC name of N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide (CID 7040530) is N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide.
What is the SMILES notation for N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide?
The canonical SMILES for N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide is O=C(Nc1ccc(Cl)cc1)c1cn(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide?
The InChIKey is BURNVDYRJIDPTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16ClN3O/c23-17-11-13-18(14-12-17)24-22(27)20-15-26(19-9-5-2-6-10-19)25-21(20)16-7-3-1-4-8-16/h1-15H,(H,24,27).
What are the key properties of N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide?
N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide has a molecular weight of 373.84 g/mol, XLogP of 5.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-1,3-diphenylpyrazole-4-carboxamide is sourced from PubChem (CID 7040530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).