About 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole
1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole (PubChem CID 70405427) has the molecular formula C17H32N2
and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole |
| PubChem CID | 70405427 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole |
| SMILES | CCCCCCCCC(C)(C)C=C(C)N1C=NCC1 |
| InChI | InChI=1S/C17H32N2/c1-5-6-7-8-9-10-11-17(3,4)14-16(2)19-13-12-18-15-19/h14-15H,5-13H2,1-4H3 |
| InChIKey | BRFNBNPJDRYOIA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole?
The IUPAC name of 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole (CID 70405427) is 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole.
What is the SMILES notation for 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole?
The canonical SMILES for 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole is CCCCCCCCC(C)(C)C=C(C)N1C=NCC1.
What is the InChIKey of 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole?
The InChIKey is BRFNBNPJDRYOIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2/c1-5-6-7-8-9-10-11-17(3,4)14-16(2)19-13-12-18-15-19/h14-15H,5-13H2,1-4H3.
What are the key properties of 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole?
1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole has a molecular weight of 264.46 g/mol, XLogP of 5.01, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-dimethyldodec-2-en-2-yl)-4,5-dihydroimidazole is sourced from PubChem (CID 70405427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).