C13H18O3Zn — CID 70405598
2-hydroxy-3,5-di(propan-2-yl)benzoic acid;zinc (PubChem CID 70405598) has the molecular formula C13H18O3Zn and a molecular weight of 287.67 g/mol. Its IUPAC name is 2-hydroxy-3,5-di(propan-2-yl)benzoic acid;zinc.
| Compound Name | 2-hydroxy-3,5-di(propan-2-yl)benzoic acid;zinc |
|---|---|
| PubChem CID | 70405598 |
| Molecular Formula | C13H18O3Zn |
| Molecular Weight | 287.67 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-hydroxy-3,5-di(propan-2-yl)benzoic acid;zinc |
| SMILES | CC(C)c1cc(C(=O)O)c(O)c(C(C)C)c1.[Zn] |
| InChI | InChI=1S/C13H18O3.Zn/c1-7(2)9-5-10(8(3)4)12(14)11(6-9)13(15)16;/h5-8,14H,1-4H3,(H,15,16); |
| InChIKey | ZIYAAPIXEOJQPI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|