C26H48N2O4 — CID 70405712
8-oxo-7-(2,2,6,6-tetramethylpiperidin-4-yl)-8-(2,2,6,6-tetramethylpiperidin-4-yl)oxyoctanoic acid (PubChem CID 70405712) has the molecular formula C26H48N2O4 and a molecular weight of 452.68 g/mol. Its IUPAC name is 8-oxo-7-(2,2,6,6-tetramethylpiperidin-4-yl)-8-(2,2,6,6-tetramethylpiperidin-4-yl)oxyoctanoic acid.
| Compound Name | 8-oxo-7-(2,2,6,6-tetramethylpiperidin-4-yl)-8-(2,2,6,6-tetramethylpiperidin-4-yl)oxyoctanoic acid |
|---|---|
| PubChem CID | 70405712 |
| Molecular Formula | C26H48N2O4 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.36 |
| IUPAC Name | 8-oxo-7-(2,2,6,6-tetramethylpiperidin-4-yl)-8-(2,2,6,6-tetramethylpiperidin-4-yl)oxyoctanoic acid |
| SMILES | CC1(C)CC(OC(=O)C(CCCCCC(=O)O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C26H48N2O4/c1-23(2)14-18(15-24(3,4)27-23)20(12-10-9-11-13-21(29)30)22(31)32-19-16-25(5,6)28-26(7,8)17-19/h18-20,27-28H,9-17H2,1-8H3,(H,29,30) |
| InChIKey | QKJCKISHUURFLH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|