About CID 70405773
CID 70405773 (PubChem CID 70405773) has the molecular formula C12H22MgN2O2
and a molecular weight of 250.62 g/mol.
Molecular Properties
| Compound Name | CID 70405773 |
| PubChem CID | 70405773 |
| Molecular Formula | C12H22MgN2O2 |
| Molecular Weight | 250.62 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | — |
| SMILES | O=C1CCCCCN1.O=C1CCCCCN1.[Mg] |
| InChI | InChI=1S/2C6H11NO.Mg/c2*8-6-4-2-1-3-5-7-6;/h2*1-5H2,(H,7,8); |
| InChIKey | ABMPLDRTDDMKHF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.62 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 70405773 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70405773?
The IUPAC name of CID 70405773 (CID 70405773) is not available.
What is the SMILES notation for CID 70405773?
The canonical SMILES for CID 70405773 is O=C1CCCCCN1.O=C1CCCCCN1.[Mg].
What is the InChIKey of CID 70405773?
The InChIKey is ABMPLDRTDDMKHF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H11NO.Mg/c2*8-6-4-2-1-3-5-7-6;/h2*1-5H2,(H,7,8);.
What are the key properties of CID 70405773?
CID 70405773 has a molecular weight of 250.62 g/mol, XLogP of 0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70405773 is sourced from PubChem (CID 70405773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).