C16H16N2O4 — CID 70406128
5-methyl-N'-(5-methyl-4-oxocyclohexa-1,5-diene-1-carbonyl)-4-oxocyclohexa-1,5-diene-1-carbohydrazide (PubChem CID 70406128) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 5-methyl-N'-(5-methyl-4-oxocyclohexa-1,5-diene-1-carbonyl)-4-oxocyclohexa-1,5-diene-1-carbohydrazide.
| Compound Name | 5-methyl-N'-(5-methyl-4-oxocyclohexa-1,5-diene-1-carbonyl)-4-oxocyclohexa-1,5-diene-1-carbohydrazide |
|---|---|
| PubChem CID | 70406128 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-methyl-N'-(5-methyl-4-oxocyclohexa-1,5-diene-1-carbonyl)-4-oxocyclohexa-1,5-diene-1-carbohydrazide |
| SMILES | CC1=CC(C(=O)NNC(=O)C2=CCC(=O)C(C)=C2)=CCC1=O |
| InChI | InChI=1S/C16H16N2O4/c1-9-7-11(3-5-13(9)19)15(21)17-18-16(22)12-4-6-14(20)10(2)8-12/h3-4,7-8H,5-6H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | MLKVSXAZJLZGDE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|