C25H50N4 — CID 70406813
(Z)-1-N'-[2-(4,5-dihydro-1H-imidazol-2-yl)ethyl]icos-11-ene-1,1-diamine (PubChem CID 70406813) has the molecular formula C25H50N4 and a molecular weight of 406.70 g/mol. Its IUPAC name is (Z)-1-N'-[2-(4,5-dihydro-1H-imidazol-2-yl)ethyl]icos-11-ene-1,1-diamine.
| Compound Name | (Z)-1-N'-[2-(4,5-dihydro-1H-imidazol-2-yl)ethyl]icos-11-ene-1,1-diamine |
|---|---|
| PubChem CID | 70406813 |
| Molecular Formula | C25H50N4 |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 406.40 |
| IUPAC Name | (Z)-1-N'-[2-(4,5-dihydro-1H-imidazol-2-yl)ethyl]icos-11-ene-1,1-diamine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(N)NCCC1=NCCN1 |
| InChI | InChI=1S/C25H50N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(26)27-21-20-25-28-22-23-29-25/h9-10,24,27H,2-8,11-23,26H2,1H3,(H,28,29)/b10-9- |
| InChIKey | DWTFYHXWMSJHJN-KTKRTIGZSA-N |
| XLogP | 6.07 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|