About benzene;tert-butyl(2-methylpentyl)diazene
benzene;tert-butyl(2-methylpentyl)diazene (PubChem CID 70406831) has the molecular formula C16H28N2
and a molecular weight of 248.41 g/mol. Its IUPAC name is benzene;tert-butyl(2-methylpentyl)diazene.
Molecular Properties
| Compound Name | benzene;tert-butyl(2-methylpentyl)diazene |
| PubChem CID | 70406831 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | benzene;tert-butyl(2-methylpentyl)diazene |
| SMILES | CCCC(C)C/N=N/C(C)(C)C.c1ccccc1 |
| InChI | InChI=1S/C10H22N2.C6H6/c1-6-7-9(2)8-11-12-10(3,4)5;1-2-4-6-5-3-1/h9H,6-8H2,1-5H3;1-6H/b12-11+; |
| InChIKey | SJDAZZXCFUFAGH-CALJPSDSSA-N |
| XLogP | 5.36 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze benzene;tert-butyl(2-methylpentyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;tert-butyl(2-methylpentyl)diazene?
The IUPAC name of benzene;tert-butyl(2-methylpentyl)diazene (CID 70406831) is benzene;tert-butyl(2-methylpentyl)diazene.
What is the SMILES notation for benzene;tert-butyl(2-methylpentyl)diazene?
The canonical SMILES for benzene;tert-butyl(2-methylpentyl)diazene is CCCC(C)C/N=N/C(C)(C)C.c1ccccc1.
What is the InChIKey of benzene;tert-butyl(2-methylpentyl)diazene?
The InChIKey is SJDAZZXCFUFAGH-CALJPSDSSA-N. The full InChI is InChI=1S/C10H22N2.C6H6/c1-6-7-9(2)8-11-12-10(3,4)5;1-2-4-6-5-3-1/h9H,6-8H2,1-5H3;1-6H/b12-11+;.
What are the key properties of benzene;tert-butyl(2-methylpentyl)diazene?
benzene;tert-butyl(2-methylpentyl)diazene has a molecular weight of 248.41 g/mol, XLogP of 5.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;tert-butyl(2-methylpentyl)diazene is sourced from PubChem (CID 70406831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).