About (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine
(Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine (PubChem CID 70406845) has the molecular formula C23H45N3
and a molecular weight of 363.63 g/mol. Its IUPAC name is (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine.
Molecular Properties
| Compound Name | (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine |
| PubChem CID | 70406845 |
| Molecular Formula | C23H45N3 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 363.36 |
| IUPAC Name | (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(N)N1C=NCC1 |
| InChI | InChI=1S/C23H45N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(24)26-21-20-25-22-26/h9-10,22-23H,2-8,11-21,24H2,1H3/b10-9- |
| InChIKey | HPLOAVUXUPXUEA-KTKRTIGZSA-N |
| XLogP | 6.43 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine?
The IUPAC name of (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine (CID 70406845) is (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine.
What is the SMILES notation for (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine?
The canonical SMILES for (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine is CCCCCCCC/C=C\CCCCCCCCCC(N)N1C=NCC1.
What is the InChIKey of (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine?
The InChIKey is HPLOAVUXUPXUEA-KTKRTIGZSA-N. The full InChI is InChI=1S/C23H45N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(24)26-21-20-25-22-26/h9-10,22-23H,2-8,11-21,24H2,1H3/b10-9-.
What are the key properties of (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine?
(Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine has a molecular weight of 363.63 g/mol, XLogP of 6.43, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(4,5-dihydroimidazol-1-yl)icos-11-en-1-amine is sourced from PubChem (CID 70406845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).