C25H23N4O4+ — CID 70407090
2-(1H-imidazol-5-yl)ethanamine;24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene (PubChem CID 70407090) has the molecular formula C25H23N4O4+ and a molecular weight of 443.48 g/mol. Its IUPAC name is 2-(1H-imidazol-5-yl)ethanamine;24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene.
| Compound Name | 2-(1H-imidazol-5-yl)ethanamine;24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene |
|---|---|
| PubChem CID | 70407090 |
| Molecular Formula | C25H23N4O4+ |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-(1H-imidazol-5-yl)ethanamine;24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene |
| SMILES | C[n+]1cc2c3c(ccc2c2ccc4cc5c(cc4c21)OCO5)OCO3.NCCc1cnc[nH]1 |
| InChI | InChI=1S/C20H14NO4.C5H9N3/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21;6-2-1-5-3-7-4-8-5/h2-8H,9-10H2,1H3;3-4H,1-2,6H2,(H,7,8)/q+1; |
| InChIKey | VRAFCYKDBKUUJR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|