C22H40O3Si — CID 70407581
(1R,2S,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-(8-hydroxyoct-1-enyl)-1,2,4,5,6,6a-hexahydropentalen-2-ol (PubChem CID 70407581) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is (1R,2S,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-(8-hydroxyoct-1-enyl)-1,2,4,5,6,6a-hexahydropentalen-2-ol.
| Compound Name | (1R,2S,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-(8-hydroxyoct-1-enyl)-1,2,4,5,6,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 70407581 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | (1R,2S,5S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-1-(8-hydroxyoct-1-enyl)-1,2,4,5,6,6a-hexahydropentalen-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC2=C[C@@H](O)[C@H](C=CCCCCCCO)[C@@H]2C1 |
| InChI | InChI=1S/C22H40O3Si/c1-22(2,3)26(4,5)25-18-14-17-15-21(24)19(20(17)16-18)12-10-8-6-7-9-11-13-23/h10,12,15,18-21,23-24H,6-9,11,13-14,16H2,1-5H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | XCWXKFLJVDPMSR-XRXFAXGQSA-N |
| XLogP | 5.20 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|