About 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide
2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide (PubChem CID 70407619) has the molecular formula C7H11NOS
and a molecular weight of 157.24 g/mol. Its IUPAC name is 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide.
Analyze 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide?
The IUPAC name of 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide (CID 70407619) is 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide.
What is the SMILES notation for 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide?
The canonical SMILES for 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide is O=S1CCC2CNCC=C21.
What is the InChIKey of 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide?
The InChIKey is IKBUJZSOUNJYAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NOS/c9-10-4-2-6-5-8-3-1-7(6)10/h1,6,8H,2-5H2.
What are the key properties of 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide?
2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide has a molecular weight of 157.24 g/mol, XLogP of 0.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3a,4,5,6-hexahydrothieno[3,2-c]pyridine 1-oxide is sourced from PubChem (CID 70407619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).