C30H48O5 — CID 70407703
(3aR,4S,5S,6aS)-4-[4,9-dimethyl-1-(oxan-2-yloxy)deca-1,8-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 70407703) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is (3aR,4S,5S,6aS)-4-[4,9-dimethyl-1-(oxan-2-yloxy)deca-1,8-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aR,4S,5S,6aS)-4-[4,9-dimethyl-1-(oxan-2-yloxy)deca-1,8-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 70407703 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | (3aR,4S,5S,6aS)-4-[4,9-dimethyl-1-(oxan-2-yloxy)deca-1,8-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CC(C)=CCCCC(C)CC=C(OC1CCCCO1)[C@H]1[C@@H]2CC(=O)C[C@@H]2C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C30H48O5/c1-21(2)10-4-5-11-22(3)14-15-26(34-28-12-6-8-16-32-28)30-25-20-24(31)18-23(25)19-27(30)35-29-13-7-9-17-33-29/h10,15,22-23,25,27-30H,4-9,11-14,16-20H2,1-3H3/t22?,23-,25-,27+,28?,29?,30-/m1/s1 |
| InChIKey | PJMNIQGVJNJLQB-PUDHARJZSA-N |
| XLogP | 7.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|