C28H44O5 — CID 70407706
(3aR,4R,5R,6aS)-4-[4,4-dimethyl-1-(oxan-2-yloxy)octa-1,7-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 70407706) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[4,4-dimethyl-1-(oxan-2-yloxy)octa-1,7-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[4,4-dimethyl-1-(oxan-2-yloxy)octa-1,7-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 70407706 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[4,4-dimethyl-1-(oxan-2-yloxy)octa-1,7-dienyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | C=CCCC(C)(C)CC=C(OC1CCCCO1)[C@@H]1[C@@H]2CC(=O)C[C@@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C28H44O5/c1-4-5-13-28(2,3)14-12-23(32-25-10-6-8-15-30-25)27-22-19-21(29)17-20(22)18-24(27)33-26-11-7-9-16-31-26/h4,12,20,22,24-27H,1,5-11,13-19H2,2-3H3/t20-,22-,24-,25?,26?,27+/m1/s1 |
| InChIKey | KQOZQZRZOCAAIW-MABKAMRGSA-N |
| XLogP | 6.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|