C12H25N3O5S — CID 70407721
4-N,4-N-diethyl-2-N,2-N-dimethylbenzene-1,2,4-triamine;sulfuric acid;hydrate (PubChem CID 70407721) has the molecular formula C12H25N3O5S and a molecular weight of 323.42 g/mol. Its IUPAC name is 4-N,4-N-diethyl-2-N,2-N-dimethylbenzene-1,2,4-triamine;sulfuric acid;hydrate.
| Compound Name | 4-N,4-N-diethyl-2-N,2-N-dimethylbenzene-1,2,4-triamine;sulfuric acid;hydrate |
|---|---|
| PubChem CID | 70407721 |
| Molecular Formula | C12H25N3O5S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 4-N,4-N-diethyl-2-N,2-N-dimethylbenzene-1,2,4-triamine;sulfuric acid;hydrate |
| SMILES | CCN(CC)c1ccc(N)c(N(C)C)c1.O.O=S(=O)(O)O |
| InChI | InChI=1S/C12H21N3.H2O4S.H2O/c1-5-15(6-2)10-7-8-11(13)12(9-10)14(3)4;1-5(2,3)4;/h7-9H,5-6,13H2,1-4H3;(H2,1,2,3,4);1H2 |
| InChIKey | JCJRVDVGBXPXMY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|