C22H39FO3 — CID 70407838
(1R,2R,3R,4R)-4-fluoro-2-[(1E)-3-hydroxy-4,7-dimethylocta-1,6-dienyl]-3-(7-hydroxyheptyl)cyclopentan-1-ol (PubChem CID 70407838) has the molecular formula C22H39FO3 and a molecular weight of 370.55 g/mol. Its IUPAC name is (1R,2R,3R,4R)-4-fluoro-2-[(1E)-3-hydroxy-4,7-dimethylocta-1,6-dienyl]-3-(7-hydroxyheptyl)cyclopentan-1-ol.
| Compound Name | (1R,2R,3R,4R)-4-fluoro-2-[(1E)-3-hydroxy-4,7-dimethylocta-1,6-dienyl]-3-(7-hydroxyheptyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 70407838 |
| Molecular Formula | C22H39FO3 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (1R,2R,3R,4R)-4-fluoro-2-[(1E)-3-hydroxy-4,7-dimethylocta-1,6-dienyl]-3-(7-hydroxyheptyl)cyclopentan-1-ol |
| SMILES | CC(C)=CCC(C)C(O)/C=C/[C@@H]1[C@@H](CCCCCCCO)[C@H](F)C[C@H]1O |
| InChI | InChI=1S/C22H39FO3/c1-16(2)10-11-17(3)21(25)13-12-19-18(20(23)15-22(19)26)9-7-5-4-6-8-14-24/h10,12-13,17-22,24-26H,4-9,11,14-15H2,1-3H3/b13-12+/t17?,18-,19-,20-,21?,22-/m1/s1 |
| InChIKey | MFKTXIXEDXOJGK-UXABDRKHSA-N |
| XLogP | 4.56 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|