About 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol
3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol (PubChem CID 70407862) has the molecular formula C5H8N4O
and a molecular weight of 140.15 g/mol. Its IUPAC name is 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol.
Molecular Properties
| Compound Name | 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol |
| PubChem CID | 70407862 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol |
| SMILES | Nc1n[nH]c(CC=CO)n1 |
| InChI | InChI=1S/C5H8N4O/c6-5-7-4(8-9-5)2-1-3-10/h1,3,10H,2H2,(H3,6,7,8,9) |
| InChIKey | MMWLXUUPQYPWAZ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol?
The IUPAC name of 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol (CID 70407862) is 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol.
What is the SMILES notation for 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol?
The canonical SMILES for 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol is Nc1n[nH]c(CC=CO)n1.
What is the InChIKey of 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol?
The InChIKey is MMWLXUUPQYPWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O/c6-5-7-4(8-9-5)2-1-3-10/h1,3,10H,2H2,(H3,6,7,8,9).
What are the key properties of 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol?
3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol has a molecular weight of 140.15 g/mol, XLogP of 0.00, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-1H-1,2,4-triazol-5-yl)prop-1-en-1-ol is sourced from PubChem (CID 70407862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).