C26H25N3O4 — CID 70408581
N-(7-methoxy-2,2-dimethyl-1,3-benzodioxol-5-yl)-4,5-diphenyl-1,3-dihydropyrazole-2-carboxamide (PubChem CID 70408581) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is N-(7-methoxy-2,2-dimethyl-1,3-benzodioxol-5-yl)-4,5-diphenyl-1,3-dihydropyrazole-2-carboxamide.
| Compound Name | N-(7-methoxy-2,2-dimethyl-1,3-benzodioxol-5-yl)-4,5-diphenyl-1,3-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 70408581 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-(7-methoxy-2,2-dimethyl-1,3-benzodioxol-5-yl)-4,5-diphenyl-1,3-dihydropyrazole-2-carboxamide |
| SMILES | COc1cc(NC(=O)N2CC(c3ccccc3)=C(c3ccccc3)N2)cc2c1OC(C)(C)O2 |
| InChI | InChI=1S/C26H25N3O4/c1-26(2)32-22-15-19(14-21(31-3)24(22)33-26)27-25(30)29-16-20(17-10-6-4-7-11-17)23(28-29)18-12-8-5-9-13-18/h4-15,28H,16H2,1-3H3,(H,27,30) |
| InChIKey | KCCKMNPLWVLJDG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|