C31H50O4 — CID 70408798
2-[[(2R,3S,3aS,6aS)-3-[(Z,3S)-3-(oxan-2-yloxy)oct-1-enyl]-5-pent-4-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane (PubChem CID 70408798) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is 2-[[(2R,3S,3aS,6aS)-3-[(Z,3S)-3-(oxan-2-yloxy)oct-1-enyl]-5-pent-4-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane.
| Compound Name | 2-[[(2R,3S,3aS,6aS)-3-[(Z,3S)-3-(oxan-2-yloxy)oct-1-enyl]-5-pent-4-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane |
|---|---|
| PubChem CID | 70408798 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | 2-[[(2R,3S,3aS,6aS)-3-[(Z,3S)-3-(oxan-2-yloxy)oct-1-enyl]-5-pent-4-enyl-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane |
| SMILES | C=CCCCC1=C[C@H]2C[C@@H](OC3CCCCO3)[C@@H](/C=C\[C@H](CCCCC)OC3CCCCO3)[C@H]2C1 |
| InChI | InChI=1S/C31H50O4/c1-3-5-7-13-24-21-25-23-29(35-31-16-10-12-20-33-31)27(28(25)22-24)18-17-26(14-8-6-4-2)34-30-15-9-11-19-32-30/h3,17-18,21,25-31H,1,4-16,19-20,22-23H2,2H3/b18-17-/t25-,26-,27-,28-,29+,30?,31?/m0/s1 |
| InChIKey | GEMBTFJBEYGCIZ-VWPOFJGMSA-N |
| XLogP | 7.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|