C40H43NO4 — CID 70408985
4-[2-[3-benzyl-4-(2-benzyl-4-nitrophenyl)phenyl]propyl]-3-methylphenol;ethoxyethane (PubChem CID 70408985) has the molecular formula C40H43NO4 and a molecular weight of 601.79 g/mol. Its IUPAC name is 4-[2-[3-benzyl-4-(2-benzyl-4-nitrophenyl)phenyl]propyl]-3-methylphenol;ethoxyethane.
| Compound Name | 4-[2-[3-benzyl-4-(2-benzyl-4-nitrophenyl)phenyl]propyl]-3-methylphenol;ethoxyethane |
|---|---|
| PubChem CID | 70408985 |
| Molecular Formula | C40H43NO4 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | 4-[2-[3-benzyl-4-(2-benzyl-4-nitrophenyl)phenyl]propyl]-3-methylphenol;ethoxyethane |
| SMILES | CCOCC.Cc1cc(O)ccc1CC(C)c1ccc(-c2ccc([N+](=O)[O-])cc2Cc2ccccc2)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C36H33NO3.C4H10O/c1-25(19-29-13-16-34(38)20-26(29)2)30-14-17-35(31(23-30)21-27-9-5-3-6-10-27)36-18-15-33(37(39)40)24-32(36)22-28-11-7-4-8-12-28;1-3-5-4-2/h3-18,20,23-25,38H,19,21-22H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | UXKAUXUTZIUGQZ-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|