About 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine
6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine (PubChem CID 7040922) has the molecular formula C15H11ClN2S
and a molecular weight of 286.79 g/mol. Its IUPAC name is 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine.
Molecular Properties
| Compound Name | 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine |
| PubChem CID | 7040922 |
| Molecular Formula | C15H11ClN2S |
| Molecular Weight | 286.79 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine |
| SMILES | ClC1=C(c2ccccc2)N=CC(c2ccncc2)S1 |
| InChI | InChI=1S/C15H11ClN2S/c16-15-14(12-4-2-1-3-5-12)18-10-13(19-15)11-6-8-17-9-7-11/h1-10,13H |
| InChIKey | KMZMJFSOJBKTAH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine?
The IUPAC name of 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine (CID 7040922) is 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine.
What is the SMILES notation for 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine?
The canonical SMILES for 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine is ClC1=C(c2ccccc2)N=CC(c2ccncc2)S1.
What is the InChIKey of 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine?
The InChIKey is KMZMJFSOJBKTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN2S/c16-15-14(12-4-2-1-3-5-12)18-10-13(19-15)11-6-8-17-9-7-11/h1-10,13H.
What are the key properties of 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine?
6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine has a molecular weight of 286.79 g/mol, XLogP of 4.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-phenyl-2-pyridin-4-yl-2H-1,4-thiazine is sourced from PubChem (CID 7040922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).