C26H42O2 — CID 70409338
2-[(3S)-1-[(1S,3aS,4R,6aS)-4-but-3-enyl-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]oct-1-en-3-yl]oxyoxane (PubChem CID 70409338) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is 2-[(3S)-1-[(1S,3aS,4R,6aS)-4-but-3-enyl-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]oct-1-en-3-yl]oxyoxane.
| Compound Name | 2-[(3S)-1-[(1S,3aS,4R,6aS)-4-but-3-enyl-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]oct-1-en-3-yl]oxyoxane |
|---|---|
| PubChem CID | 70409338 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 2-[(3S)-1-[(1S,3aS,4R,6aS)-4-but-3-enyl-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]oct-1-en-3-yl]oxyoxane |
| SMILES | C=CCC[C@H]1C(=C)C[C@@H]2[C@@H]1CC[C@H]2C=C[C@H](CCCCC)OC1CCCCO1 |
| InChI | InChI=1S/C26H42O2/c1-4-6-8-11-22(28-26-13-9-10-18-27-26)16-14-21-15-17-24-23(12-7-5-2)20(3)19-25(21)24/h5,14,16,21-26H,2-4,6-13,15,17-19H2,1H3/t21-,22+,23+,24-,25+,26?/m1/s1 |
| InChIKey | CTCVGIOWINVRLQ-SWNTYUTLSA-N |
| XLogP | 7.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|