C12H15NO — CID 70409407
1,2,3,3a,4,6a,9a,9b-octahydrobenzo[de]quinolin-7-one (PubChem CID 70409407) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1,2,3,3a,4,6a,9a,9b-octahydrobenzo[de]quinolin-7-one.
| Compound Name | 1,2,3,3a,4,6a,9a,9b-octahydrobenzo[de]quinolin-7-one |
|---|---|
| PubChem CID | 70409407 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1,2,3,3a,4,6a,9a,9b-octahydrobenzo[de]quinolin-7-one |
| SMILES | O=C1C=CC2NCCC3CC=CC1C32 |
| InChI | InChI=1S/C12H15NO/c14-11-5-4-10-12-8(6-7-13-10)2-1-3-9(11)12/h1,3-5,8-10,12-13H,2,6-7H2 |
| InChIKey | DACHKADJTOVQQB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|