About 2,6-Dimethoxyphenol
2,6-Dimethoxyphenol (PubChem CID 7041) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is 2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 2,6-Dimethoxyphenol |
| PubChem CID | 7041 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2,6-dimethoxyphenol |
| SMILES | COC1=C(C(=CC=C1)OC)O |
| InChI | InChI=1S/C8H10O3/c1-10-6-4-3-5-7(11-2)8(6)9/h3-5,9H,1-2H3 |
| InChIKey | KLIDCXVFHGNTTM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | 104 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-Dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-Dimethoxyphenol?
The IUPAC name of 2,6-Dimethoxyphenol (CID 7041) is 2,6-dimethoxyphenol.
What is the SMILES notation for 2,6-Dimethoxyphenol?
The canonical SMILES for 2,6-Dimethoxyphenol is COC1=C(C(=CC=C1)OC)O.
What is the InChIKey of 2,6-Dimethoxyphenol?
The InChIKey is KLIDCXVFHGNTTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-10-6-4-3-5-7(11-2)8(6)9/h3-5,9H,1-2H3.
What are the key properties of 2,6-Dimethoxyphenol?
2,6-Dimethoxyphenol has a molecular weight of 154.16 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-Dimethoxyphenol is sourced from PubChem (CID 7041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).