C18H24OS — CID 70410068
4-[(1E,3E)-cyclododeca-1,3-dien-1-yl]sulfanylphenol (PubChem CID 70410068) has the molecular formula C18H24OS and a molecular weight of 288.46 g/mol. Its IUPAC name is 4-[(1E,3E)-cyclododeca-1,3-dien-1-yl]sulfanylphenol.
| Compound Name | 4-[(1E,3E)-cyclododeca-1,3-dien-1-yl]sulfanylphenol |
|---|---|
| PubChem CID | 70410068 |
| Molecular Formula | C18H24OS |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-[(1E,3E)-cyclododeca-1,3-dien-1-yl]sulfanylphenol |
| SMILES | Oc1ccc(S/C2=C/C=C/CCCCCCCC2)cc1 |
| InChI | InChI=1S/C18H24OS/c19-16-12-14-18(15-13-16)20-17-10-8-6-4-2-1-3-5-7-9-11-17/h6,8,10,12-15,19H,1-5,7,9,11H2/b8-6+,17-10+ |
| InChIKey | ZZOGZACFQKWYBO-FVKMJGKXSA-N |
| XLogP | 6.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |