C31H58O4Si2 — CID 70410095
[(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(Z,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl acetate (PubChem CID 70410095) has the molecular formula C31H58O4Si2 and a molecular weight of 550.97 g/mol. Its IUPAC name is [(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(Z,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl acetate.
| Compound Name | [(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(Z,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70410095 |
| Molecular Formula | C31H58O4Si2 |
| Molecular Weight | 550.97 g/mol |
| Exact Mass | 550.39 |
| IUPAC Name | [(3aS,5R,6S,6aS)-5-[tert-butyl(dimethyl)silyl]oxy-6-[(Z,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl acetate |
| SMILES | CCCCC[C@@H](/C=C\[C@H]1[C@H]2CC(COC(C)=O)=C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H58O4Si2/c1-13-14-15-16-26(34-36(9,10)30(3,4)5)17-18-27-28-20-24(22-33-23(2)32)19-25(28)21-29(27)35-37(11,12)31(6,7)8/h17-19,25-29H,13-16,20-22H2,1-12H3/b18-17-/t25-,26-,27-,28-,29+/m0/s1 |
| InChIKey | BCHZTLLFMQWGHZ-WUNDWDHWSA-N |
| XLogP | 9.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.97 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|