C24H38N2O9 — CID 70410107
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;4-(2,2,3-trimethyl-6-methylidenecyclohexyl)but-3-en-2-one (PubChem CID 70410107) has the molecular formula C24H38N2O9 and a molecular weight of 498.57 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;4-(2,2,3-trimethyl-6-methylidenecyclohexyl)but-3-en-2-one.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;4-(2,2,3-trimethyl-6-methylidenecyclohexyl)but-3-en-2-one |
|---|---|
| PubChem CID | 70410107 |
| Molecular Formula | C24H38N2O9 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;4-(2,2,3-trimethyl-6-methylidenecyclohexyl)but-3-en-2-one |
| SMILES | C=C1CCC(C)C(C)(C)C1C=CC(C)=O.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H22O.C10H16N2O8/c1-10-6-7-11(2)14(4,5)13(10)9-8-12(3)15;13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h8-9,11,13H,1,6-7H2,2-5H3;1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | AIRBFAJBCVBJLK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 172.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|