C28H24N2O4 — CID 70410159
2-benzhydryl-3-methyl-2-[(1S,5R)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid (PubChem CID 70410159) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is 2-benzhydryl-3-methyl-2-[(1S,5R)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid.
| Compound Name | 2-benzhydryl-3-methyl-2-[(1S,5R)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid |
|---|---|
| PubChem CID | 70410159 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-benzhydryl-3-methyl-2-[(1S,5R)-7-oxo-3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-6-yl]but-3-enoic acid |
| SMILES | C=C(C)C(C(=O)O)(C(c1ccccc1)c1ccccc1)N1C(=O)[C@H]2N=C(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C28H24N2O4/c1-18(2)28(27(32)33,22(19-12-6-3-7-13-19)20-14-8-4-9-15-20)30-25(31)23-26(30)34-24(29-23)21-16-10-5-11-17-21/h3-17,22-23,26H,1H2,2H3,(H,32,33)/t23-,26-,28?/m1/s1 |
| InChIKey | NTNDMAOVOXEPNM-ONCFSFCTSA-N |
| XLogP | 4.23 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|