About 4-(1H-imidazol-2-yl)-1,4-dihydropyridine
4-(1H-imidazol-2-yl)-1,4-dihydropyridine (PubChem CID 70410241) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 4-(1H-imidazol-2-yl)-1,4-dihydropyridine.
Molecular Properties
| Compound Name | 4-(1H-imidazol-2-yl)-1,4-dihydropyridine |
| PubChem CID | 70410241 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 4-(1H-imidazol-2-yl)-1,4-dihydropyridine |
| SMILES | C1=CC(c2ncc[nH]2)C=CN1 |
| InChI | InChI=1S/C8H9N3/c1-3-9-4-2-7(1)8-10-5-6-11-8/h1-7,9H,(H,10,11) |
| InChIKey | RDYWIVQYOOZSKZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1H-imidazol-2-yl)-1,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-imidazol-2-yl)-1,4-dihydropyridine?
The IUPAC name of 4-(1H-imidazol-2-yl)-1,4-dihydropyridine (CID 70410241) is 4-(1H-imidazol-2-yl)-1,4-dihydropyridine.
What is the SMILES notation for 4-(1H-imidazol-2-yl)-1,4-dihydropyridine?
The canonical SMILES for 4-(1H-imidazol-2-yl)-1,4-dihydropyridine is C1=CC(c2ncc[nH]2)C=CN1.
What is the InChIKey of 4-(1H-imidazol-2-yl)-1,4-dihydropyridine?
The InChIKey is RDYWIVQYOOZSKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-3-9-4-2-7(1)8-10-5-6-11-8/h1-7,9H,(H,10,11).
What are the key properties of 4-(1H-imidazol-2-yl)-1,4-dihydropyridine?
4-(1H-imidazol-2-yl)-1,4-dihydropyridine has a molecular weight of 147.18 g/mol, XLogP of 1.12, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-imidazol-2-yl)-1,4-dihydropyridine is sourced from PubChem (CID 70410241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).