About 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate
3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate (PubChem CID 70410251) has the molecular formula C15H19NO6
and a molecular weight of 309.32 g/mol. Its IUPAC name is 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate |
| PubChem CID | 70410251 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate |
| SMILES | C=CC(=O)OC.Cc1ccc(C(CC(=O)O)C[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H13NO4.C4H6O2/c1-8-2-4-9(5-3-8)10(6-11(13)14)7-12(15)16;1-3-4(5)6-2/h2-5,10H,6-7H2,1H3,(H,13,14);3H,1H2,2H3 |
| InChIKey | UXQKHCCDRIFEIJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate?
The IUPAC name of 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate (CID 70410251) is 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate.
What is the SMILES notation for 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate?
The canonical SMILES for 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate is C=CC(=O)OC.Cc1ccc(C(CC(=O)O)C[N+](=O)[O-])cc1.
What is the InChIKey of 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate?
The InChIKey is UXQKHCCDRIFEIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4.C4H6O2/c1-8-2-4-9(5-3-8)10(6-11(13)14)7-12(15)16;1-3-4(5)6-2/h2-5,10H,6-7H2,1H3,(H,13,14);3H,1H2,2H3.
What are the key properties of 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate?
3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate has a molecular weight of 309.32 g/mol, XLogP of 2.18, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)-4-nitrobutanoic acid;methyl prop-2-enoate is sourced from PubChem (CID 70410251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).