About 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine
2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine (PubChem CID 70410493) has the molecular formula C13H12OS
and a molecular weight of 216.31 g/mol. Its IUPAC name is 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine.
Molecular Properties
| Compound Name | 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine |
| PubChem CID | 70410493 |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine |
| SMILES | C1=CC2=CSC3=C(CCC=C3)OC2C=C1 |
| InChI | InChI=1S/C13H12OS/c1-2-6-11-10(5-1)9-15-13-8-4-3-7-12(13)14-11/h1-2,4-6,8-9,11H,3,7H2 |
| InChIKey | MPNYJRORBQTVDQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine?
The IUPAC name of 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine (CID 70410493) is 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine.
What is the SMILES notation for 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine?
The canonical SMILES for 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine is C1=CC2=CSC3=C(CCC=C3)OC2C=C1.
What is the InChIKey of 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine?
The InChIKey is MPNYJRORBQTVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12OS/c1-2-6-11-10(5-1)9-15-13-8-4-3-7-12(13)14-11/h1-2,4-6,8-9,11H,3,7H2.
What are the key properties of 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine?
2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine has a molecular weight of 216.31 g/mol, XLogP of 3.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10a-dihydro-1H-benzo[b][1,5]benzoxathiepine is sourced from PubChem (CID 70410493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).