About 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid
2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid (PubChem CID 70410520) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
| PubChem CID | 70410520 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
| SMILES | O=C(O)C12CCCC1CCC1CCN12 |
| InChI | InChI=1S/C11H17NO2/c13-10(14)11-6-1-2-8(11)3-4-9-5-7-12(9)11/h8-9H,1-7H2,(H,13,14) |
| InChIKey | CCHVXRNALSZVJV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid?
The IUPAC name of 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid (CID 70410520) is 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid.
What is the SMILES notation for 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid?
The canonical SMILES for 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid is O=C(O)C12CCCC1CCC1CCN12.
What is the InChIKey of 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid?
The InChIKey is CCHVXRNALSZVJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c13-10(14)11-6-1-2-8(11)3-4-9-5-7-12(9)11/h8-9H,1-7H2,(H,13,14).
What are the key properties of 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid?
2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid has a molecular weight of 195.26 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid is sourced from PubChem (CID 70410520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).