About 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine
2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine (PubChem CID 70410708) has the molecular formula C9H4ClF2N3O
and a molecular weight of 243.60 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine |
| PubChem CID | 70410708 |
| Molecular Formula | C9H4ClF2N3O |
| Molecular Weight | 243.60 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine |
| SMILES | Fc1nc(F)nc(Oc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C9H4ClF2N3O/c10-5-1-3-6(4-2-5)16-9-14-7(11)13-8(12)15-9/h1-4H |
| InChIKey | LHPNSCWEOLGFSH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine?
The IUPAC name of 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine (CID 70410708) is 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine.
What is the SMILES notation for 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine?
The canonical SMILES for 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine is Fc1nc(F)nc(Oc2ccc(Cl)cc2)n1.
What is the InChIKey of 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine?
The InChIKey is LHPNSCWEOLGFSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClF2N3O/c10-5-1-3-6(4-2-5)16-9-14-7(11)13-8(12)15-9/h1-4H.
What are the key properties of 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine?
2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine has a molecular weight of 243.60 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenoxy)-4,6-difluoro-1,3,5-triazine is sourced from PubChem (CID 70410708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).