About N,1-dipentyl-2,3-dihydroindol-6-amine
N,1-dipentyl-2,3-dihydroindol-6-amine (PubChem CID 70410805) has the molecular formula C18H30N2
and a molecular weight of 274.45 g/mol. Its IUPAC name is N,1-dipentyl-2,3-dihydroindol-6-amine.
Molecular Properties
| Compound Name | N,1-dipentyl-2,3-dihydroindol-6-amine |
| PubChem CID | 70410805 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N,1-dipentyl-2,3-dihydroindol-6-amine |
| SMILES | CCCCCNc1ccc2c(c1)N(CCCCC)CC2 |
| InChI | InChI=1S/C18H30N2/c1-3-5-7-12-19-17-10-9-16-11-14-20(18(16)15-17)13-8-6-4-2/h9-10,15,19H,3-8,11-14H2,1-2H3 |
| InChIKey | CPFVFSSMVVQWJI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,1-dipentyl-2,3-dihydroindol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dipentyl-2,3-dihydroindol-6-amine?
The IUPAC name of N,1-dipentyl-2,3-dihydroindol-6-amine (CID 70410805) is N,1-dipentyl-2,3-dihydroindol-6-amine.
What is the SMILES notation for N,1-dipentyl-2,3-dihydroindol-6-amine?
The canonical SMILES for N,1-dipentyl-2,3-dihydroindol-6-amine is CCCCCNc1ccc2c(c1)N(CCCCC)CC2.
What is the InChIKey of N,1-dipentyl-2,3-dihydroindol-6-amine?
The InChIKey is CPFVFSSMVVQWJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2/c1-3-5-7-12-19-17-10-9-16-11-14-20(18(16)15-17)13-8-6-4-2/h9-10,15,19H,3-8,11-14H2,1-2H3.
What are the key properties of N,1-dipentyl-2,3-dihydroindol-6-amine?
N,1-dipentyl-2,3-dihydroindol-6-amine has a molecular weight of 274.45 g/mol, XLogP of 4.84, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dipentyl-2,3-dihydroindol-6-amine is sourced from PubChem (CID 70410805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).