About 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine
1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine (PubChem CID 70410883) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine.
Molecular Properties
| Compound Name | 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine |
| PubChem CID | 70410883 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine |
| SMILES | C=CC(N)C1(N(CC)CC)CCCC1 |
| InChI | InChI=1S/C12H24N2/c1-4-11(13)12(9-7-8-10-12)14(5-2)6-3/h4,11H,1,5-10,13H2,2-3H3 |
| InChIKey | OIUYJXQDUPVKRT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine?
The IUPAC name of 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine (CID 70410883) is 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine.
What is the SMILES notation for 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine?
The canonical SMILES for 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine is C=CC(N)C1(N(CC)CC)CCCC1.
What is the InChIKey of 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine?
The InChIKey is OIUYJXQDUPVKRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-4-11(13)12(9-7-8-10-12)14(5-2)6-3/h4,11H,1,5-10,13H2,2-3H3.
What are the key properties of 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine?
1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine has a molecular weight of 196.34 g/mol, XLogP of 2.15, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-aminoprop-2-enyl)-N,N-diethylcyclopentan-1-amine is sourced from PubChem (CID 70410883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).