About (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide
(2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide (PubChem CID 70410913) has the molecular formula C17H28N2O3
and a molecular weight of 308.42 g/mol. Its IUPAC name is (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide.
Molecular Properties
| Compound Name | (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide |
| PubChem CID | 70410913 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide |
| SMILES | Cc1nc(CCC[C@H](O)C(=O)NCC2CCCCC2)oc1C |
| InChI | InChI=1S/C17H28N2O3/c1-12-13(2)22-16(19-12)10-6-9-15(20)17(21)18-11-14-7-4-3-5-8-14/h14-15,20H,3-11H2,1-2H3,(H,18,21)/t15-/m0/s1 |
| InChIKey | JGEFFCIYDAOYMI-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide?
The IUPAC name of (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide (CID 70410913) is (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide.
What is the SMILES notation for (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide?
The canonical SMILES for (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide is Cc1nc(CCC[C@H](O)C(=O)NCC2CCCCC2)oc1C.
What is the InChIKey of (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide?
The InChIKey is JGEFFCIYDAOYMI-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H28N2O3/c1-12-13(2)22-16(19-12)10-6-9-15(20)17(21)18-11-14-7-4-3-5-8-14/h14-15,20H,3-11H2,1-2H3,(H,18,21)/t15-/m0/s1.
What are the key properties of (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide?
(2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide has a molecular weight of 308.42 g/mol, XLogP of 2.67, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(cyclohexylmethyl)-5-(4,5-dimethyl-1,3-oxazol-2-yl)-2-hydroxypentanamide is sourced from PubChem (CID 70410913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).