C15H17N5S — CID 7041096
1-[1-(4-imidazol-1-ylphenyl)ethenylamino]-3-prop-2-enylthiourea (PubChem CID 7041096) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-[1-(4-imidazol-1-ylphenyl)ethenylamino]-3-prop-2-enylthiourea.
| Compound Name | 1-[1-(4-imidazol-1-ylphenyl)ethenylamino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 7041096 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-[1-(4-imidazol-1-ylphenyl)ethenylamino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNC(=C)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C15H17N5S/c1-3-8-17-15(21)19-18-12(2)13-4-6-14(7-5-13)20-10-9-16-11-20/h3-7,9-11,18H,1-2,8H2,(H2,17,19,21) |
| InChIKey | YXFHLKPNZDFXGA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|