C14H14FN3O6 — CID 70411284
3-[(2S,4S)-6-fluoro-2-methyl-3,4-dihydro-2H-chromen-4-yl]imidazole-4-carboxylic acid;nitric acid (PubChem CID 70411284) has the molecular formula C14H14FN3O6 and a molecular weight of 339.28 g/mol. Its IUPAC name is 3-[(2S,4S)-6-fluoro-2-methyl-3,4-dihydro-2H-chromen-4-yl]imidazole-4-carboxylic acid;nitric acid.
| Compound Name | 3-[(2S,4S)-6-fluoro-2-methyl-3,4-dihydro-2H-chromen-4-yl]imidazole-4-carboxylic acid;nitric acid |
|---|---|
| PubChem CID | 70411284 |
| Molecular Formula | C14H14FN3O6 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 3-[(2S,4S)-6-fluoro-2-methyl-3,4-dihydro-2H-chromen-4-yl]imidazole-4-carboxylic acid;nitric acid |
| SMILES | C[C@H]1C[C@H](n2cncc2C(=O)O)c2cc(F)ccc2O1.O=[N+]([O-])O |
| InChI | InChI=1S/C14H13FN2O3.HNO3/c1-8-4-11(17-7-16-6-12(17)14(18)19)10-5-9(15)2-3-13(10)20-8;2-1(3)4/h2-3,5-8,11H,4H2,1H3,(H,18,19);(H,2,3,4)/t8-,11-;/m0./s1 |
| InChIKey | SFCOAHMQXBQXQN-RWHJDYSMSA-N |
| XLogP | 2.13 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|