C20H37N2O3S+ — CID 70411453
diethyl-heptyl-[1-hydroxy-2-[4-(methanesulfonamido)phenyl]ethyl]azanium (PubChem CID 70411453) has the molecular formula C20H37N2O3S+ and a molecular weight of 385.59 g/mol. Its IUPAC name is diethyl-heptyl-[1-hydroxy-2-[4-(methanesulfonamido)phenyl]ethyl]azanium.
| Compound Name | diethyl-heptyl-[1-hydroxy-2-[4-(methanesulfonamido)phenyl]ethyl]azanium |
|---|---|
| PubChem CID | 70411453 |
| Molecular Formula | C20H37N2O3S+ |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | diethyl-heptyl-[1-hydroxy-2-[4-(methanesulfonamido)phenyl]ethyl]azanium |
| SMILES | CCCCCCC[N+](CC)(CC)C(O)Cc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H37N2O3S/c1-5-8-9-10-11-16-22(6-2,7-3)20(23)17-18-12-14-19(15-13-18)21-26(4,24)25/h12-15,20-21,23H,5-11,16-17H2,1-4H3/q+1 |
| InChIKey | NZKDPTUYXFTMQO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|