About 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one
12-(oxan-2-yloxy)dodeca-6,10-dien-3-one (PubChem CID 70411892) has the molecular formula C17H28O3
and a molecular weight of 280.41 g/mol. Its IUPAC name is 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one.
Molecular Properties
| Compound Name | 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one |
| PubChem CID | 70411892 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one |
| SMILES | CCC(=O)CCC=CCCC=CCOC1CCCCO1 |
| InChI | InChI=1S/C17H28O3/c1-2-16(18)12-8-6-4-3-5-7-10-14-19-17-13-9-11-15-20-17/h4,6-7,10,17H,2-3,5,8-9,11-15H2,1H3 |
| InChIKey | YYURKRBCJXWGHS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one?
The IUPAC name of 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one (CID 70411892) is 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one.
What is the SMILES notation for 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one?
The canonical SMILES for 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one is CCC(=O)CCC=CCCC=CCOC1CCCCO1.
What is the InChIKey of 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one?
The InChIKey is YYURKRBCJXWGHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O3/c1-2-16(18)12-8-6-4-3-5-7-10-14-19-17-13-9-11-15-20-17/h4,6-7,10,17H,2-3,5,8-9,11-15H2,1H3.
What are the key properties of 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one?
12-(oxan-2-yloxy)dodeca-6,10-dien-3-one has a molecular weight of 280.41 g/mol, XLogP of 4.18, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 12-(oxan-2-yloxy)dodeca-6,10-dien-3-one is sourced from PubChem (CID 70411892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).