C12H23N5O2S — CID 70412444
2-N,4-N-bis(1-methoxypropyl)-6-methylsulfanyl-1,3,5-triazine-2,4-diamine (PubChem CID 70412444) has the molecular formula C12H23N5O2S and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-N,4-N-bis(1-methoxypropyl)-6-methylsulfanyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(1-methoxypropyl)-6-methylsulfanyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 70412444 |
| Molecular Formula | C12H23N5O2S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-N,4-N-bis(1-methoxypropyl)-6-methylsulfanyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCC(Nc1nc(NC(CC)OC)nc(SC)n1)OC |
| InChI | InChI=1S/C12H23N5O2S/c1-6-8(18-3)13-10-15-11(14-9(7-2)19-4)17-12(16-10)20-5/h8-9H,6-7H2,1-5H3,(H2,13,14,15,16,17) |
| InChIKey | HSDBYPLSIHIFLX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|