C10H15BrN+ — CID 70412754
4-bromo-1,1-dimethyl-2,3,6,7-tetrahydroindol-1-ium (PubChem CID 70412754) has the molecular formula C10H15BrN+ and a molecular weight of 229.14 g/mol. Its IUPAC name is 4-bromo-1,1-dimethyl-2,3,6,7-tetrahydroindol-1-ium.
| Compound Name | 4-bromo-1,1-dimethyl-2,3,6,7-tetrahydroindol-1-ium |
|---|---|
| PubChem CID | 70412754 |
| Molecular Formula | C10H15BrN+ |
| Molecular Weight | 229.14 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4-bromo-1,1-dimethyl-2,3,6,7-tetrahydroindol-1-ium |
| SMILES | C[N+]1(C)CCC2=C1CCC=C2Br |
| InChI | InChI=1S/C10H15BrN/c1-12(2)7-6-8-9(11)4-3-5-10(8)12/h4H,3,5-7H2,1-2H3/q+1 |
| InChIKey | AMCJUMIGPUWNTJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|