C16H13BrFNO4 — CID 70412826
2-[2-bromo-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]acetic acid (PubChem CID 70412826) has the molecular formula C16H13BrFNO4 and a molecular weight of 382.19 g/mol. Its IUPAC name is 2-[2-bromo-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]acetic acid.
| Compound Name | 2-[2-bromo-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 70412826 |
| Molecular Formula | C16H13BrFNO4 |
| Molecular Weight | 382.19 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2-[2-bromo-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Br |
| InChI | InChI=1S/C16H13BrFNO4/c17-11-7-12(18)13(5-8(11)6-14(20)21)19-15(22)9-3-1-2-4-10(9)16(19)23/h5,7H,1-4,6H2,(H,20,21) |
| InChIKey | GUQHWBPDKHHNQJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|